C8H9NY2-2 — CID 59475941
4,5,6,7-tetrahydro-3H-indole-5,7-diide;bis(yttrium) (PubChem CID 59475941) has the molecular formula C8H9NY2-2 and a molecular weight of 296.98 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-3H-indole-5,7-diide;bis(yttrium).
| Compound Name | 4,5,6,7-tetrahydro-3H-indole-5,7-diide;bis(yttrium) |
|---|---|
| PubChem CID | 59475941 |
| Molecular Formula | C8H9NY2-2 |
| Molecular Weight | 296.98 g/mol |
| Exact Mass | 296.89 |
| IUPAC Name | 4,5,6,7-tetrahydro-3H-indole-5,7-diide;bis(yttrium) |
| SMILES | C1=NC2=C(C1)C[CH-]C[CH-]2.[Y].[Y] |
| InChI | InChI=1S/C8H9N.2Y/c1-2-4-8-7(3-1)5-6-9-8;;/h1,4,6H,2-3,5H2;;/q-2;; |
| InChIKey | JTEUPNQHTPVWMI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.98 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|