C17H31N — CID 59105252
3-butyl-5,6-ditert-butyl-3,4-dihydropyridine (PubChem CID 59105252) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is 3-butyl-5,6-ditert-butyl-3,4-dihydropyridine.
| Compound Name | 3-butyl-5,6-ditert-butyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 59105252 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | 3-butyl-5,6-ditert-butyl-3,4-dihydropyridine |
| SMILES | CCCCC1C=NC(C(C)(C)C)=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C17H31N/c1-8-9-10-13-11-14(16(2,3)4)15(18-12-13)17(5,6)7/h12-13H,8-11H2,1-7H3 |
| InChIKey | CNTQGIPCCCOJHQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |