C13H20N+ — CID 132990534
(7aR)-2-pentan-3-yl-4,7a-dihydro-3H-cyclopenta[c]pyridin-2-ium (PubChem CID 132990534) has the molecular formula C13H20N+ and a molecular weight of 190.31 g/mol. Its IUPAC name is (7aR)-2-pentan-3-yl-4,7a-dihydro-3H-cyclopenta[c]pyridin-2-ium.
| Compound Name | (7aR)-2-pentan-3-yl-4,7a-dihydro-3H-cyclopenta[c]pyridin-2-ium |
|---|---|
| PubChem CID | 132990534 |
| Molecular Formula | C13H20N+ |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | (7aR)-2-pentan-3-yl-4,7a-dihydro-3H-cyclopenta[c]pyridin-2-ium |
| SMILES | CCC(CC)[N+]1=C[C@@H]2C=CC=C2CC1 |
| InChI | InChI=1S/C13H20N/c1-3-13(4-2)14-9-8-11-6-5-7-12(11)10-14/h5-7,10,12-13H,3-4,8-9H2,1-2H3/q+1/t12-/m0/s1 |
| InChIKey | RXXGGOCABXLTAK-LBPRGKRZSA-N |
| XLogP | 2.77 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|