C11H16N+ — CID 122386249
(3aR)-1-propan-2-yl-3,3a-dihydro-2H-indol-1-ium (PubChem CID 122386249) has the molecular formula C11H16N+ and a molecular weight of 162.26 g/mol. Its IUPAC name is (3aR)-1-propan-2-yl-3,3a-dihydro-2H-indol-1-ium.
| Compound Name | (3aR)-1-propan-2-yl-3,3a-dihydro-2H-indol-1-ium |
|---|---|
| PubChem CID | 122386249 |
| Molecular Formula | C11H16N+ |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | (3aR)-1-propan-2-yl-3,3a-dihydro-2H-indol-1-ium |
| SMILES | CC(C)[N+]1=C2C=CC=C[C@H]2CC1 |
| InChI | InChI=1S/C11H16N/c1-9(2)12-8-7-10-5-3-4-6-11(10)12/h3-6,9-10H,7-8H2,1-2H3/q+1/t10-/m0/s1 |
| InChIKey | GQISFPVMIZHOKY-JTQLQIEISA-N |
| XLogP | 1.99 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|