C11H17N — CID 91173425
ethane;2-methyl-3a,7a-dihydro-3H-indole (PubChem CID 91173425) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is ethane;2-methyl-3a,7a-dihydro-3H-indole.
| Compound Name | ethane;2-methyl-3a,7a-dihydro-3H-indole |
|---|---|
| PubChem CID | 91173425 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | ethane;2-methyl-3a,7a-dihydro-3H-indole |
| SMILES | CC.CC1=NC2C=CC=CC2C1 |
| InChI | InChI=1S/C9H11N.C2H6/c1-7-6-8-4-2-3-5-9(8)10-7;1-2/h2-5,8-9H,6H2,1H3;1-2H3 |
| InChIKey | IOXNKAMHYMYGBP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |