C12H14N+ — CID 91394282
4,6,6a,7-tetrahydro-3H-pyrido[2,1-a]isoindol-5-ium (PubChem CID 91394282) has the molecular formula C12H14N+ and a molecular weight of 172.25 g/mol. Its IUPAC name is 4,6,6a,7-tetrahydro-3H-pyrido[2,1-a]isoindol-5-ium.
| Compound Name | 4,6,6a,7-tetrahydro-3H-pyrido[2,1-a]isoindol-5-ium |
|---|---|
| PubChem CID | 91394282 |
| Molecular Formula | C12H14N+ |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 4,6,6a,7-tetrahydro-3H-pyrido[2,1-a]isoindol-5-ium |
| SMILES | C1=CCC2C[N+]3=C(C=CCC3)C2=C1 |
| InChI | InChI=1S/C12H14N/c1-2-6-11-10(5-1)9-13-8-4-3-7-12(11)13/h1-3,6-7,10H,4-5,8-9H2/q+1 |
| InChIKey | BIQNCFGSBMJZQH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|