About 1,3-dimethyl-7,7a-dihydro-1H-cyclopenta[c]pyridine
1,3-dimethyl-7,7a-dihydro-1H-cyclopenta[c]pyridine (PubChem CID 90876564) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 1,3-dimethyl-7,7a-dihydro-1H-cyclopenta[c]pyridine.
Analyze 1,3-dimethyl-7,7a-dihydro-1H-cyclopenta[c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-7,7a-dihydro-1H-cyclopenta[c]pyridine?
The IUPAC name of 1,3-dimethyl-7,7a-dihydro-1H-cyclopenta[c]pyridine (CID 90876564) is 1,3-dimethyl-7,7a-dihydro-1H-cyclopenta[c]pyridine.
What is the SMILES notation for 1,3-dimethyl-7,7a-dihydro-1H-cyclopenta[c]pyridine?
The canonical SMILES for 1,3-dimethyl-7,7a-dihydro-1H-cyclopenta[c]pyridine is CC1=NC(C)C2CC=CC2=C1.
What is the InChIKey of 1,3-dimethyl-7,7a-dihydro-1H-cyclopenta[c]pyridine?
The InChIKey is NWVQOPMAWVYUMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-7-6-9-4-3-5-10(9)8(2)11-7/h3-4,6,8,10H,5H2,1-2H3.
What are the key properties of 1,3-dimethyl-7,7a-dihydro-1H-cyclopenta[c]pyridine?
1,3-dimethyl-7,7a-dihydro-1H-cyclopenta[c]pyridine has a molecular weight of 147.22 g/mol, XLogP of 2.35, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-7,7a-dihydro-1H-cyclopenta[c]pyridine is sourced from PubChem (CID 90876564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).