C13H23N — CID 91466382
ethane;2-methyl-3,3a-dihydro-2H-indole (PubChem CID 91466382) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is ethane;2-methyl-3,3a-dihydro-2H-indole.
| Compound Name | ethane;2-methyl-3,3a-dihydro-2H-indole |
|---|---|
| PubChem CID | 91466382 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | ethane;2-methyl-3,3a-dihydro-2H-indole |
| SMILES | CC.CC.CC1CC2C=CC=CC2=N1 |
| InChI | InChI=1S/C9H11N.2C2H6/c1-7-6-8-4-2-3-5-9(8)10-7;2*1-2/h2-5,7-8H,6H2,1H3;2*1-2H3 |
| InChIKey | RNYISYVXPAZGGV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |