C12H20N2 — CID 142886823
(2Z)-N-methyl-2-(1-methylpiperidin-4-yl)penta-2,4-dien-1-imine (PubChem CID 142886823) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (2Z)-N-methyl-2-(1-methylpiperidin-4-yl)penta-2,4-dien-1-imine.
| Compound Name | (2Z)-N-methyl-2-(1-methylpiperidin-4-yl)penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142886823 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (2Z)-N-methyl-2-(1-methylpiperidin-4-yl)penta-2,4-dien-1-imine |
| SMILES | C=C/C=C(\C=N\C)C1CCN(C)CC1 |
| InChI | InChI=1S/C12H20N2/c1-4-5-12(10-13-2)11-6-8-14(3)9-7-11/h4-5,10-11H,1,6-9H2,2-3H3/b12-5+,13-10+ |
| InChIKey | ADIRNVBHPLDKAF-SPUCVAIDSA-N |
| XLogP | 2.14 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|