C11H19N — CID 123158822
1-methyl-4-penta-1,3-dien-3-ylpiperidine (PubChem CID 123158822) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 1-methyl-4-penta-1,3-dien-3-ylpiperidine.
| Compound Name | 1-methyl-4-penta-1,3-dien-3-ylpiperidine |
|---|---|
| PubChem CID | 123158822 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 1-methyl-4-penta-1,3-dien-3-ylpiperidine |
| SMILES | C=CC(=CC)C1CCN(C)CC1 |
| InChI | InChI=1S/C11H19N/c1-4-10(5-2)11-6-8-12(3)9-7-11/h4-5,11H,1,6-9H2,2-3H3 |
| InChIKey | PRCCNPUMJANYOJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|