C12H21N — CID 123529216
1-ethyl-4-penta-1,3-dien-3-ylpiperidine (PubChem CID 123529216) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 1-ethyl-4-penta-1,3-dien-3-ylpiperidine.
| Compound Name | 1-ethyl-4-penta-1,3-dien-3-ylpiperidine |
|---|---|
| PubChem CID | 123529216 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 1-ethyl-4-penta-1,3-dien-3-ylpiperidine |
| SMILES | C=CC(=CC)C1CCN(CC)CC1 |
| InChI | InChI=1S/C12H21N/c1-4-11(5-2)12-7-9-13(6-3)10-8-12/h4-5,12H,1,6-10H2,2-3H3 |
| InChIKey | GZCJIHYFOZKNMC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|