C12H20N2 — CID 145106243
5-[(3-methylpiperidin-1-yl)methyl]-2,3-dihydropyridine (PubChem CID 145106243) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 5-[(3-methylpiperidin-1-yl)methyl]-2,3-dihydropyridine.
| Compound Name | 5-[(3-methylpiperidin-1-yl)methyl]-2,3-dihydropyridine |
|---|---|
| PubChem CID | 145106243 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 5-[(3-methylpiperidin-1-yl)methyl]-2,3-dihydropyridine |
| SMILES | CC1CCCN(CC2=CCCN=C2)C1 |
| InChI | InChI=1S/C12H20N2/c1-11-4-3-7-14(9-11)10-12-5-2-6-13-8-12/h5,8,11H,2-4,6-7,9-10H2,1H3 |
| InChIKey | PQYMMSPIDLTOAZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |