C10H20N2 — CID 174270836
(Z)-3-methyl-N-(3-methyliminopropyl)pent-3-en-2-amine (PubChem CID 174270836) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (Z)-3-methyl-N-(3-methyliminopropyl)pent-3-en-2-amine.
| Compound Name | (Z)-3-methyl-N-(3-methyliminopropyl)pent-3-en-2-amine |
|---|---|
| PubChem CID | 174270836 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (Z)-3-methyl-N-(3-methyliminopropyl)pent-3-en-2-amine |
| SMILES | C/C=C(/C)C(C)NCC/C=N/C |
| InChI | InChI=1S/C10H20N2/c1-5-9(2)10(3)12-8-6-7-11-4/h5,7,10,12H,6,8H2,1-4H3/b9-5-,11-7+ |
| InChIKey | IWZYVBFIJSATSI-KGAZIEBHSA-N |
| XLogP | 2.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|