C13H20N2 — CID 142152429
3,7,9,9-tetramethyl-3,6,7,8-tetrahydropyrido[3,4-b]azepine (PubChem CID 142152429) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 3,7,9,9-tetramethyl-3,6,7,8-tetrahydropyrido[3,4-b]azepine.
| Compound Name | 3,7,9,9-tetramethyl-3,6,7,8-tetrahydropyrido[3,4-b]azepine |
|---|---|
| PubChem CID | 142152429 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 3,7,9,9-tetramethyl-3,6,7,8-tetrahydropyrido[3,4-b]azepine |
| SMILES | CC1C=CC2=C(N=C1)C(C)(C)NC(C)C2 |
| InChI | InChI=1S/C13H20N2/c1-9-5-6-11-7-10(2)15-13(3,4)12(11)14-8-9/h5-6,8-10,15H,7H2,1-4H3 |
| InChIKey | ZKSBYXXCPPZHOB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |