C10H19N2+ — CID 59957987
methyl-[4-methyl-6-(methylamino)hepta-3,5-dien-2-ylidene]azanium (PubChem CID 59957987) has the molecular formula C10H19N2+ and a molecular weight of 167.28 g/mol. Its IUPAC name is methyl-[4-methyl-6-(methylamino)hepta-3,5-dien-2-ylidene]azanium.
| Compound Name | methyl-[4-methyl-6-(methylamino)hepta-3,5-dien-2-ylidene]azanium |
|---|---|
| PubChem CID | 59957987 |
| Molecular Formula | C10H19N2+ |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.15 |
| IUPAC Name | methyl-[4-methyl-6-(methylamino)hepta-3,5-dien-2-ylidene]azanium |
| SMILES | CNC(C)=CC(C)=C/C(C)=[NH+]/C |
| InChI | InChI=1S/C10H18N2/c1-8(6-9(2)11-4)7-10(3)12-5/h6-7,11H,1-5H3/p+1/b8-7?,9-6?,12-10+ |
| InChIKey | RVWZHRQGNSYTJQ-OEZRMVIGSA-O |
| XLogP | 0.23 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|