C21H34N3+ — CID 91589718
[4-ethyl-5-methylimino-11-(prop-2-enylamino)trideca-3,7,10,12-tetraen-3-yl]-methyl-methylideneazanium (PubChem CID 91589718) has the molecular formula C21H34N3+ and a molecular weight of 328.52 g/mol. Its IUPAC name is [4-ethyl-5-methylimino-11-(prop-2-enylamino)trideca-3,7,10,12-tetraen-3-yl]-methyl-methylideneazanium.
| Compound Name | [4-ethyl-5-methylimino-11-(prop-2-enylamino)trideca-3,7,10,12-tetraen-3-yl]-methyl-methylideneazanium |
|---|---|
| PubChem CID | 91589718 |
| Molecular Formula | C21H34N3+ |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.27 |
| IUPAC Name | [4-ethyl-5-methylimino-11-(prop-2-enylamino)trideca-3,7,10,12-tetraen-3-yl]-methyl-methylideneazanium |
| SMILES | C=CCNC(C=C)=CCC=CC/C(=N\C)C(CC)=C(CC)[N+](=C)C |
| InChI | InChI=1S/C21H34N3/c1-8-17-23-18(9-2)15-13-12-14-16-20(22-5)19(10-3)21(11-4)24(6)7/h8-9,12,14-15,23H,1-2,6,10-11,13,16-17H2,3-5,7H3/q+1/b14-12?,18-15?,21-19?,22-20+ |
| InChIKey | GBNSRWDEDMEFEV-MWICLCEKSA-N |
| XLogP | 4.66 |
| TPSA | 27.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|