C27H35N3 — CID 134188582
(3Z,5E,7E,9E)-7-ethenyl-N-methyl-9-[(3Z)-6-methyl-3-[(Z)-3-(methylideneamino)prop-2-enylidene]-2H-pyridin-4-yl]-6-[(E)-prop-1-enyl]undeca-3,5,7,9-tetraen-1-amine (PubChem CID 134188582) has the molecular formula C27H35N3 and a molecular weight of 401.60 g/mol. Its IUPAC name is (3Z,5E,7E,9E)-7-ethenyl-N-methyl-9-[(3Z)-6-methyl-3-[(Z)-3-(methylideneamino)prop-2-enylidene]-2H-pyridin-4-yl]-6-[(E)-prop-1-enyl]undeca-3,5,7,9-tetraen-1-amine.
| Compound Name | (3Z,5E,7E,9E)-7-ethenyl-N-methyl-9-[(3Z)-6-methyl-3-[(Z)-3-(methylideneamino)prop-2-enylidene]-2H-pyridin-4-yl]-6-[(E)-prop-1-enyl]undeca-3,5,7,9-tetraen-1-amine |
|---|---|
| PubChem CID | 134188582 |
| Molecular Formula | C27H35N3 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | (3Z,5E,7E,9E)-7-ethenyl-N-methyl-9-[(3Z)-6-methyl-3-[(Z)-3-(methylideneamino)prop-2-enylidene]-2H-pyridin-4-yl]-6-[(E)-prop-1-enyl]undeca-3,5,7,9-tetraen-1-amine |
| SMILES | C=CC(=C/C(=C\C)C1=CC(C)=NC/C1=C\C=C/N=C)C(/C=C/C)=C/C=C\CCNC |
| InChI | InChI=1S/C27H35N3/c1-7-14-25(15-11-10-12-17-28-5)23(8-2)20-24(9-3)27-19-22(4)30-21-26(27)16-13-18-29-6/h7-11,13-16,18-20,28H,2,6,12,17,21H2,1,3-5H3/b11-10-,14-7+,18-13-,23-20+,24-9+,25-15+,26-16+ |
| InChIKey | UOPXPTLQHSOPJQ-OYBXPKFMSA-N |
| XLogP | 6.25 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|