C25H33N3 — CID 123920861
(4E,7Z)-4,13-dimethyl-2-N-[(E)-3-(4-methylidene-1-pyridinyl)prop-1-enyl]tetradeca-4,7,9,13-tetraene-2,3-diimine (PubChem CID 123920861) has the molecular formula C25H33N3 and a molecular weight of 375.56 g/mol. Its IUPAC name is (4E,7Z)-4,13-dimethyl-2-N-[(E)-3-(4-methylidene-1-pyridinyl)prop-1-enyl]tetradeca-4,7,9,13-tetraene-2,3-diimine.
| Compound Name | (4E,7Z)-4,13-dimethyl-2-N-[(E)-3-(4-methylidene-1-pyridinyl)prop-1-enyl]tetradeca-4,7,9,13-tetraene-2,3-diimine |
|---|---|
| PubChem CID | 123920861 |
| Molecular Formula | C25H33N3 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | (4E,7Z)-4,13-dimethyl-2-N-[(E)-3-(4-methylidene-1-pyridinyl)prop-1-enyl]tetradeca-4,7,9,13-tetraene-2,3-diimine |
| SMILES | [H]/N=C(C(\C)=C\C/C=C\C=CCCC(=C)C)/C(C)=N/C=C/CN1C=CC(=C)C=C1 |
| InChI | InChI=1S/C25H33N3/c1-21(2)13-10-8-6-7-9-11-14-23(4)25(26)24(5)27-17-12-18-28-19-15-22(3)16-20-28/h6-9,12,14-17,19-20,26H,1,3,10-11,13,18H2,2,4-5H3/b8-6?,9-7-,17-12+,23-14+,26-25+,27-24+ |
| InChIKey | ILMUKOTZBIKDAX-PDICGUJYSA-N |
| XLogP | 6.69 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|