C25H37N3 — CID 123207993
(3E,7E)-5-N-[4-(3,4-dimethyl-4H-pyridin-1-yl)but-2-en-2-yl]-7-ethyldodeca-3,7,10-triene-5,6-diimine (PubChem CID 123207993) has the molecular formula C25H37N3 and a molecular weight of 379.59 g/mol. Its IUPAC name is (3E,7E)-5-N-[4-(3,4-dimethyl-4H-pyridin-1-yl)but-2-en-2-yl]-7-ethyldodeca-3,7,10-triene-5,6-diimine.
| Compound Name | (3E,7E)-5-N-[4-(3,4-dimethyl-4H-pyridin-1-yl)but-2-en-2-yl]-7-ethyldodeca-3,7,10-triene-5,6-diimine |
|---|---|
| PubChem CID | 123207993 |
| Molecular Formula | C25H37N3 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.30 |
| IUPAC Name | (3E,7E)-5-N-[4-(3,4-dimethyl-4H-pyridin-1-yl)but-2-en-2-yl]-7-ethyldodeca-3,7,10-triene-5,6-diimine |
| SMILES | [H]N=C(/C(=C/CC=CC)CC)C(/C=C/CC)=N/C(C)=CCN1C=CC(C)C(C)=C1 |
| InChI | InChI=1S/C25H37N3/c1-7-10-12-13-23(9-3)25(26)24(14-11-8-2)27-22(6)16-18-28-17-15-20(4)21(5)19-28/h7,10-11,13-17,19-20,26H,8-9,12,18H2,1-6H3/b10-7?,14-11+,22-16?,23-13+,26-25+,27-24+ |
| InChIKey | AJMXEMAJMBKQFX-BSQXPUHZSA-N |
| XLogP | 6.99 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|