C30H48N2 — CID 143621274
(Z)-N-[(6Z,8Z)-deca-6,8-dienyl]-1-(3-methylcyclohexa-1,5-dien-1-yl)pent-2-en-1-imine;(1Z,3Z)-4-ethylhexa-1,3,5-trien-1-amine;molecular hydrogen (PubChem CID 143621274) has the molecular formula C30H48N2 and a molecular weight of 436.73 g/mol. Its IUPAC name is (Z)-N-[(6Z,8Z)-deca-6,8-dienyl]-1-(3-methylcyclohexa-1,5-dien-1-yl)pent-2-en-1-imine;(1Z,3Z)-4-ethylhexa-1,3,5-trien-1-amine;molecular hydrogen.
| Compound Name | (Z)-N-[(6Z,8Z)-deca-6,8-dienyl]-1-(3-methylcyclohexa-1,5-dien-1-yl)pent-2-en-1-imine;(1Z,3Z)-4-ethylhexa-1,3,5-trien-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 143621274 |
| Molecular Formula | C30H48N2 |
| Molecular Weight | 436.73 g/mol |
| Exact Mass | 436.38 |
| IUPAC Name | (Z)-N-[(6Z,8Z)-deca-6,8-dienyl]-1-(3-methylcyclohexa-1,5-dien-1-yl)pent-2-en-1-imine;(1Z,3Z)-4-ethylhexa-1,3,5-trien-1-amine;molecular hydrogen |
| SMILES | C/C=C\C=C/CCCCC/N=C(\C=C/CC)C1=CC(C)CC=C1.C=C/C(=C\C=C/N)CC.[H][H] |
| InChI | InChI=1S/C22H33N.C8H13N.H2/c1-4-6-8-9-10-11-12-13-18-23-22(17-7-5-2)21-16-14-15-20(3)19-21;1-3-8(4-2)6-5-7-9;/h4,6-9,14,16-17,19-20H,5,10-13,15,18H2,1-3H3;3,5-7H,1,4,9H2,2H3;1H/b6-4-,9-8-,17-7-,23-22+;7-5-,8-6+; |
| InChIKey | DAKONQMEVJIBMC-QBICCASKSA-N |
| XLogP | 8.84 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.73 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|