C17H34N2 — CID 142076091
ethane;(Z)-2,2,4,4-tetramethyl-5-[(Z)-prop-1-enyl]iminooct-6-en-1-amine (PubChem CID 142076091) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is ethane;(Z)-2,2,4,4-tetramethyl-5-[(Z)-prop-1-enyl]iminooct-6-en-1-amine.
| Compound Name | ethane;(Z)-2,2,4,4-tetramethyl-5-[(Z)-prop-1-enyl]iminooct-6-en-1-amine |
|---|---|
| PubChem CID | 142076091 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | ethane;(Z)-2,2,4,4-tetramethyl-5-[(Z)-prop-1-enyl]iminooct-6-en-1-amine |
| SMILES | C/C=C\N=C(/C=C\C)C(C)(C)CC(C)(C)CN.CC |
| InChI | InChI=1S/C15H28N2.C2H6/c1-7-9-13(17-10-8-2)15(5,6)11-14(3,4)12-16;1-2/h7-10H,11-12,16H2,1-6H3;1-2H3/b9-7-,10-8-,17-13+; |
| InChIKey | HMNASVYMHGABQU-ICUBMNSVSA-N |
| XLogP | 4.96 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|