C16H25N — CID 91300094
(Z)-N-[(1E,3Z)-4-methylhepta-1,3,5-trienyl]oct-5-en-4-imine (PubChem CID 91300094) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is (Z)-N-[(1E,3Z)-4-methylhepta-1,3,5-trienyl]oct-5-en-4-imine.
| Compound Name | (Z)-N-[(1E,3Z)-4-methylhepta-1,3,5-trienyl]oct-5-en-4-imine |
|---|---|
| PubChem CID | 91300094 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | (Z)-N-[(1E,3Z)-4-methylhepta-1,3,5-trienyl]oct-5-en-4-imine |
| SMILES | CC=C/C(C)=C\C=C\N=C(\C=C/CC)CCC |
| InChI | InChI=1S/C16H25N/c1-5-8-13-16(11-7-3)17-14-9-12-15(4)10-6-2/h6,8-10,12-14H,5,7,11H2,1-4H3/b10-6?,13-8-,14-9+,15-12-,17-16+ |
| InChIKey | SDGLTEINSZGWHZ-ARUMNPQASA-N |
| XLogP | 5.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|