C17H26N2 — CID 123989743
(4E,6E,8Z)-5,6,9-trimethyl-8-[(propan-2-ylideneamino)methylidene]deca-4,6,9-trien-3-imine (PubChem CID 123989743) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is (4E,6E,8Z)-5,6,9-trimethyl-8-[(propan-2-ylideneamino)methylidene]deca-4,6,9-trien-3-imine.
| Compound Name | (4E,6E,8Z)-5,6,9-trimethyl-8-[(propan-2-ylideneamino)methylidene]deca-4,6,9-trien-3-imine |
|---|---|
| PubChem CID | 123989743 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | (4E,6E,8Z)-5,6,9-trimethyl-8-[(propan-2-ylideneamino)methylidene]deca-4,6,9-trien-3-imine |
| SMILES | [H]/N=C(/C=C(C)/C(C)=C\C(=C\N=C(C)C)C(=C)C)CC |
| InChI | InChI=1S/C17H26N2/c1-8-17(18)10-15(7)14(6)9-16(12(2)3)11-19-13(4)5/h9-11,18H,2,8H2,1,3-7H3/b14-9+,15-10+,16-11-,18-17+ |
| InChIKey | LDQORMSWEAUKGW-HNAAFDMRSA-N |
| XLogP | 5.25 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|