C16H21N2+ — CID 135020789
N-methyl-2-[(2Z)-2-(3-methylbut-2-enylidene)indol-1-ium-3-yl]ethanamine (PubChem CID 135020789) has the molecular formula C16H21N2+ and a molecular weight of 241.36 g/mol. Its IUPAC name is N-methyl-2-[(2Z)-2-(3-methylbut-2-enylidene)indol-1-ium-3-yl]ethanamine.
| Compound Name | N-methyl-2-[(2Z)-2-(3-methylbut-2-enylidene)indol-1-ium-3-yl]ethanamine |
|---|---|
| PubChem CID | 135020789 |
| Molecular Formula | C16H21N2+ |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | N-methyl-2-[(2Z)-2-(3-methylbut-2-enylidene)indol-1-ium-3-yl]ethanamine |
| SMILES | CNCCC1=c2ccccc2=[NH+]/C1=C\C=C(C)C |
| InChI | InChI=1S/C16H20N2/c1-12(2)8-9-16-14(10-11-17-3)13-6-4-5-7-15(13)18-16/h4-9,17H,10-11H2,1-3H3/p+1/b16-9- |
| InChIKey | QCGUXTSCBUDIOE-SXGWCWSVSA-O |
| XLogP | 0.01 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |