C12H16N2 — CID 129169872
(4E)-4-(2-ethenyliminopropylidene)-N-methylcyclohexa-1,5-dien-1-amine (PubChem CID 129169872) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (4E)-4-(2-ethenyliminopropylidene)-N-methylcyclohexa-1,5-dien-1-amine.
| Compound Name | (4E)-4-(2-ethenyliminopropylidene)-N-methylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 129169872 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (4E)-4-(2-ethenyliminopropylidene)-N-methylcyclohexa-1,5-dien-1-amine |
| SMILES | C=C/N=C(C)/C=C1/C=CC(NC)=CC1 |
| InChI | InChI=1S/C12H16N2/c1-4-14-10(2)9-11-5-7-12(13-3)8-6-11/h4-5,7-9,13H,1,6H2,2-3H3/b11-9-,14-10+ |
| InChIKey | FLZWAJRTMDIBEU-JIYPUEFQSA-N |
| XLogP | 2.58 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|