C17H23FN2 — CID 135161473
(1E,3E)-N-[3-[[(E)-4-ethenylhex-4-en-3-ylidene]amino]prop-1-en-2-yl]-4-fluorohexa-1,3,5-trien-1-amine (PubChem CID 135161473) has the molecular formula C17H23FN2 and a molecular weight of 274.38 g/mol. Its IUPAC name is (1E,3E)-N-[3-[[(E)-4-ethenylhex-4-en-3-ylidene]amino]prop-1-en-2-yl]-4-fluorohexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3E)-N-[3-[[(E)-4-ethenylhex-4-en-3-ylidene]amino]prop-1-en-2-yl]-4-fluorohexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 135161473 |
| Molecular Formula | C17H23FN2 |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | (1E,3E)-N-[3-[[(E)-4-ethenylhex-4-en-3-ylidene]amino]prop-1-en-2-yl]-4-fluorohexa-1,3,5-trien-1-amine |
| SMILES | C=C/C(F)=C\C=C\NC(=C)C/N=C(CC)/C(C=C)=C/C |
| InChI | InChI=1S/C17H23FN2/c1-6-15(7-2)17(9-4)20-13-14(5)19-12-10-11-16(18)8-3/h6-8,10-12,19H,1,3,5,9,13H2,2,4H3/b12-10+,15-7+,16-11+,20-17+ |
| InChIKey | RGFAWPRRGQMRNX-STYNLAJXSA-N |
| XLogP | 4.63 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|