C12H16N2 — CID 123690321
7-methyl-5-(1,2,3,6-tetrahydropyridin-4-yl)-4H-azepine (PubChem CID 123690321) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 7-methyl-5-(1,2,3,6-tetrahydropyridin-4-yl)-4H-azepine.
| Compound Name | 7-methyl-5-(1,2,3,6-tetrahydropyridin-4-yl)-4H-azepine |
|---|---|
| PubChem CID | 123690321 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 7-methyl-5-(1,2,3,6-tetrahydropyridin-4-yl)-4H-azepine |
| SMILES | CC1=NC=CCC(C2=CCNCC2)=C1 |
| InChI | InChI=1S/C12H16N2/c1-10-9-12(3-2-6-14-10)11-4-7-13-8-5-11/h2,4,6,9,13H,3,5,7-8H2,1H3 |
| InChIKey | MAFMEOZGXSBXAH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |