C26H32N2 — CID 123933874
3-[5-cyclohepta-1,3,6-trien-1-yl-2-(3-methyl-3,3a,6,7-tetrahydro-2H-indol-6-yl)cyclohepta-1,3,5-trien-1-yl]propan-1-amine (PubChem CID 123933874) has the molecular formula C26H32N2 and a molecular weight of 372.56 g/mol. Its IUPAC name is 3-[5-cyclohepta-1,3,6-trien-1-yl-2-(3-methyl-3,3a,6,7-tetrahydro-2H-indol-6-yl)cyclohepta-1,3,5-trien-1-yl]propan-1-amine.
| Compound Name | 3-[5-cyclohepta-1,3,6-trien-1-yl-2-(3-methyl-3,3a,6,7-tetrahydro-2H-indol-6-yl)cyclohepta-1,3,5-trien-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 123933874 |
| Molecular Formula | C26H32N2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 3-[5-cyclohepta-1,3,6-trien-1-yl-2-(3-methyl-3,3a,6,7-tetrahydro-2H-indol-6-yl)cyclohepta-1,3,5-trien-1-yl]propan-1-amine |
| SMILES | CC1CN=C2CC(C3=C(CCCN)CC=C(C4=CC=CCC=C4)C=C3)C=CC21 |
| InChI | InChI=1S/C26H32N2/c1-19-18-28-26-17-23(13-14-24(19)26)25-15-12-21(10-11-22(25)9-6-16-27)20-7-4-2-3-5-8-20/h2,4-5,7-8,10,12-15,19,23-24H,3,6,9,11,16-18,27H2,1H3 |
| InChIKey | UMEYVLZFONGKMH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|