C12H22N2 — CID 153404821
4-[C-[(Z)-but-1-enyl]-N-methylcarbonimidoyl]cyclohexan-1-amine (PubChem CID 153404821) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 4-[C-[(Z)-but-1-enyl]-N-methylcarbonimidoyl]cyclohexan-1-amine.
| Compound Name | 4-[C-[(Z)-but-1-enyl]-N-methylcarbonimidoyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 153404821 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 4-[C-[(Z)-but-1-enyl]-N-methylcarbonimidoyl]cyclohexan-1-amine |
| SMILES | CC/C=C\C(=N/C)C1CCC(N)CC1 |
| InChI | InChI=1S/C12H22N2/c1-3-4-5-12(14-2)10-6-8-11(13)9-7-10/h4-5,10-11H,3,6-9,13H2,1-2H3/b5-4-,14-12+ |
| InChIKey | UPRRTFMHXGNKOP-NPKGFUJDSA-N |
| XLogP | 2.54 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|