C15H26N2 — CID 123377160
1-(4-ethylcyclohexyl)-2-methyl-3,7-dihydro-2H-azepin-6-imine (PubChem CID 123377160) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 1-(4-ethylcyclohexyl)-2-methyl-3,7-dihydro-2H-azepin-6-imine.
| Compound Name | 1-(4-ethylcyclohexyl)-2-methyl-3,7-dihydro-2H-azepin-6-imine |
|---|---|
| PubChem CID | 123377160 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 1-(4-ethylcyclohexyl)-2-methyl-3,7-dihydro-2H-azepin-6-imine |
| SMILES | [H]/N=C1\C=CCC(C)N(C2CCC(CC)CC2)C1 |
| InChI | InChI=1S/C15H26N2/c1-3-13-7-9-15(10-8-13)17-11-14(16)6-4-5-12(17)2/h4,6,12-13,15-16H,3,5,7-11H2,1-2H3/b16-14+ |
| InChIKey | ZBIFPZXFRRHFIX-JQIJEIRASA-N |
| XLogP | 3.63 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|