C19H37N — CID 91223281
4-ethyl-3,6,7,8,10-pentamethyldodeca-2,8-dien-5-amine (PubChem CID 91223281) has the molecular formula C19H37N and a molecular weight of 279.51 g/mol. Its IUPAC name is 4-ethyl-3,6,7,8,10-pentamethyldodeca-2,8-dien-5-amine.
| Compound Name | 4-ethyl-3,6,7,8,10-pentamethyldodeca-2,8-dien-5-amine |
|---|---|
| PubChem CID | 91223281 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | 4-ethyl-3,6,7,8,10-pentamethyldodeca-2,8-dien-5-amine |
| SMILES | CC=C(C)C(CC)C(N)C(C)C(C)C(C)=CC(C)CC |
| InChI | InChI=1S/C19H37N/c1-9-13(4)12-15(6)16(7)17(8)19(20)18(11-3)14(5)10-2/h10,12-13,16-19H,9,11,20H2,1-8H3 |
| InChIKey | VWKJJXNVHJMCOJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|