C21H39F2N — CID 146492450
(7E,9E)-10,11-difluoro-2,3,7-trimethyl-5-(5-methylhexan-3-yl)undeca-7,9-dien-1-amine (PubChem CID 146492450) has the molecular formula C21H39F2N and a molecular weight of 343.55 g/mol. Its IUPAC name is (7E,9E)-10,11-difluoro-2,3,7-trimethyl-5-(5-methylhexan-3-yl)undeca-7,9-dien-1-amine.
| Compound Name | (7E,9E)-10,11-difluoro-2,3,7-trimethyl-5-(5-methylhexan-3-yl)undeca-7,9-dien-1-amine |
|---|---|
| PubChem CID | 146492450 |
| Molecular Formula | C21H39F2N |
| Molecular Weight | 343.55 g/mol |
| Exact Mass | 343.31 |
| IUPAC Name | (7E,9E)-10,11-difluoro-2,3,7-trimethyl-5-(5-methylhexan-3-yl)undeca-7,9-dien-1-amine |
| SMILES | CCC(CC(C)C)C(C/C(C)=C/C=C(/F)CF)CC(C)C(C)CN |
| InChI | InChI=1S/C21H39F2N/c1-7-19(10-15(2)3)20(12-17(5)18(6)14-24)11-16(4)8-9-21(23)13-22/h8-9,15,17-20H,7,10-14,24H2,1-6H3/b16-8+,21-9+ |
| InChIKey | SMXKCJCTZNAWIH-GLRRQXCISA-N |
| XLogP | 6.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.55 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|