C29H55N5 — CID 123948674
2-N-[10-[(2-amino-3-ethylidene-4,5-dihydro-2H-pyridin-6-yl)methylidene]-11-ethyl-7-(methyliminomethyl)tridecan-2-yl]-2-methylpropane-1,2-diamine (PubChem CID 123948674) has the molecular formula C29H55N5 and a molecular weight of 473.79 g/mol. Its IUPAC name is 2-N-[10-[(2-amino-3-ethylidene-4,5-dihydro-2H-pyridin-6-yl)methylidene]-11-ethyl-7-(methyliminomethyl)tridecan-2-yl]-2-methylpropane-1,2-diamine.
| Compound Name | 2-N-[10-[(2-amino-3-ethylidene-4,5-dihydro-2H-pyridin-6-yl)methylidene]-11-ethyl-7-(methyliminomethyl)tridecan-2-yl]-2-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 123948674 |
| Molecular Formula | C29H55N5 |
| Molecular Weight | 473.79 g/mol |
| Exact Mass | 473.45 |
| IUPAC Name | 2-N-[10-[(2-amino-3-ethylidene-4,5-dihydro-2H-pyridin-6-yl)methylidene]-11-ethyl-7-(methyliminomethyl)tridecan-2-yl]-2-methylpropane-1,2-diamine |
| SMILES | CC=C1CCC(C=C(CCC(/C=N/C)CCCCC(C)NC(C)(C)CN)C(CC)CC)=NC1N |
| InChI | InChI=1S/C29H55N5/c1-8-24(9-2)26(19-27-18-17-25(10-3)28(31)33-27)16-15-23(20-32-7)14-12-11-13-22(4)34-29(5,6)21-30/h10,19-20,22-24,28,34H,8-9,11-18,21,30-31H2,1-7H3/b25-10?,26-19?,32-20+ |
| InChIKey | MKVSLCASEPECAR-UHORFKGSSA-N |
| XLogP | 6.19 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.79 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|