C22H43N5 — CID 123321481
2-ethyl-2-(ethylideneamino)-N'-[(8-methyl-1,5-diazacycloundec-8-en-3-yl)methyl]-4-methylidenehexane-1,6-diamine (PubChem CID 123321481) has the molecular formula C22H43N5 and a molecular weight of 377.62 g/mol. Its IUPAC name is 2-ethyl-2-(ethylideneamino)-N'-[(8-methyl-1,5-diazacycloundec-8-en-3-yl)methyl]-4-methylidenehexane-1,6-diamine.
| Compound Name | 2-ethyl-2-(ethylideneamino)-N'-[(8-methyl-1,5-diazacycloundec-8-en-3-yl)methyl]-4-methylidenehexane-1,6-diamine |
|---|---|
| PubChem CID | 123321481 |
| Molecular Formula | C22H43N5 |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 377.35 |
| IUPAC Name | 2-ethyl-2-(ethylideneamino)-N'-[(8-methyl-1,5-diazacycloundec-8-en-3-yl)methyl]-4-methylidenehexane-1,6-diamine |
| SMILES | C=C(CCNCC1CNCCC=C(C)CCNC1)CC(CC)(CN)/N=C/C |
| InChI | InChI=1S/C22H43N5/c1-5-22(18-23,27-6-2)14-20(4)10-13-26-17-21-15-24-11-7-8-19(3)9-12-25-16-21/h6,8,21,24-26H,4-5,7,9-18,23H2,1-3H3/b19-8?,27-6+ |
| InChIKey | XBJMTRAQAMNESW-GDEVJFLKSA-N |
| XLogP | 2.65 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|