C24H43N3 — CID 143825822
3-N-[(Z)-3-(2-ethyliminoethyl)pent-3-enyl]-1-N-methyl-2-[(3Z)-6-methylhepta-1,3,5-trien-2-yl]hexane-1,3-diamine (PubChem CID 143825822) has the molecular formula C24H43N3 and a molecular weight of 373.63 g/mol. Its IUPAC name is 3-N-[(Z)-3-(2-ethyliminoethyl)pent-3-enyl]-1-N-methyl-2-[(3Z)-6-methylhepta-1,3,5-trien-2-yl]hexane-1,3-diamine.
| Compound Name | 3-N-[(Z)-3-(2-ethyliminoethyl)pent-3-enyl]-1-N-methyl-2-[(3Z)-6-methylhepta-1,3,5-trien-2-yl]hexane-1,3-diamine |
|---|---|
| PubChem CID | 143825822 |
| Molecular Formula | C24H43N3 |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 373.35 |
| IUPAC Name | 3-N-[(Z)-3-(2-ethyliminoethyl)pent-3-enyl]-1-N-methyl-2-[(3Z)-6-methylhepta-1,3,5-trien-2-yl]hexane-1,3-diamine |
| SMILES | C=C(/C=C\C=C(C)C)C(CNC)C(CCC)NCC/C(=C/C)C/C=N/CC |
| InChI | InChI=1S/C24H43N3/c1-8-12-24(27-18-16-22(9-2)15-17-26-10-3)23(19-25-7)21(6)14-11-13-20(4)5/h9,11,13-14,17,23-25,27H,6,8,10,12,15-16,18-19H2,1-5,7H3/b14-11-,22-9+,26-17+ |
| InChIKey | RMPKDMSIPGXKHD-AMLLVAFWSA-N |
| XLogP | 5.48 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|