C28H42N2 — CID 142844915
7-(4,6-dimethylcyclohex-3-en-1-yl)-4-hexyl-1,4,5,6,7,8,11,12-octahydroazepino[4,5-d][1]benzazepine (PubChem CID 142844915) has the molecular formula C28H42N2 and a molecular weight of 406.66 g/mol. Its IUPAC name is 7-(4,6-dimethylcyclohex-3-en-1-yl)-4-hexyl-1,4,5,6,7,8,11,12-octahydroazepino[4,5-d][1]benzazepine.
| Compound Name | 7-(4,6-dimethylcyclohex-3-en-1-yl)-4-hexyl-1,4,5,6,7,8,11,12-octahydroazepino[4,5-d][1]benzazepine |
|---|---|
| PubChem CID | 142844915 |
| Molecular Formula | C28H42N2 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | 7-(4,6-dimethylcyclohex-3-en-1-yl)-4-hexyl-1,4,5,6,7,8,11,12-octahydroazepino[4,5-d][1]benzazepine |
| SMILES | CCCCCCC1CC2=C(CC=N1)C1=C(C=CCC1)NC(C1CC=C(C)CC1C)C2 |
| InChI | InChI=1S/C28H42N2/c1-4-5-6-7-10-23-18-22-19-28(24-14-13-20(2)17-21(24)3)30-27-12-9-8-11-26(27)25(22)15-16-29-23/h9,12-13,16,21,23-24,28,30H,4-8,10-11,14-15,17-19H2,1-3H3 |
| InChIKey | LHIVMEFOUGVKPD-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|