C25H37N2+ — CID 123288955
1-[5-(3,4-dihydro-2H-pyridin-1-ium-1-yl)-3-(2-ethylbuta-2,3-dienyl)-7-methylcyclohepta-2,4-dien-1-yl]-N-ethylbut-2-en-1-amine (PubChem CID 123288955) has the molecular formula C25H37N2+ and a molecular weight of 365.59 g/mol. Its IUPAC name is 1-[5-(3,4-dihydro-2H-pyridin-1-ium-1-yl)-3-(2-ethylbuta-2,3-dienyl)-7-methylcyclohepta-2,4-dien-1-yl]-N-ethylbut-2-en-1-amine.
| Compound Name | 1-[5-(3,4-dihydro-2H-pyridin-1-ium-1-yl)-3-(2-ethylbuta-2,3-dienyl)-7-methylcyclohepta-2,4-dien-1-yl]-N-ethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 123288955 |
| Molecular Formula | C25H37N2+ |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 365.30 |
| IUPAC Name | 1-[5-(3,4-dihydro-2H-pyridin-1-ium-1-yl)-3-(2-ethylbuta-2,3-dienyl)-7-methylcyclohepta-2,4-dien-1-yl]-N-ethylbut-2-en-1-amine |
| SMILES | C=C=C(CC)CC1=CC(C(C=CC)NCC)C(C)CC([N+]2=C=CCCC2)=C1 |
| InChI | InChI=1S/C25H37N2/c1-6-13-25(26-9-4)24-19-22(17-21(7-2)8-3)18-23(16-20(24)5)27-14-11-10-12-15-27/h6,11,13,18-20,24-26H,2,8-10,12,15-17H2,1,3-5H3/q+1 |
| InChIKey | AECHTUHYXBSNMG-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|