C19H34N2 — CID 118181213
(3Z)-4-N-ethyl-3-ethylidene-6-methyl-5-prop-1-en-2-yl-2-N-propylocta-1,7-diene-2,4-diamine (PubChem CID 118181213) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is (3Z)-4-N-ethyl-3-ethylidene-6-methyl-5-prop-1-en-2-yl-2-N-propylocta-1,7-diene-2,4-diamine.
| Compound Name | (3Z)-4-N-ethyl-3-ethylidene-6-methyl-5-prop-1-en-2-yl-2-N-propylocta-1,7-diene-2,4-diamine |
|---|---|
| PubChem CID | 118181213 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | (3Z)-4-N-ethyl-3-ethylidene-6-methyl-5-prop-1-en-2-yl-2-N-propylocta-1,7-diene-2,4-diamine |
| SMILES | C=CC(C)C(C(=C)C)C(NCC)/C(=C/C)C(=C)NCCC |
| InChI | InChI=1S/C19H34N2/c1-9-13-21-16(8)17(11-3)19(20-12-4)18(14(5)6)15(7)10-2/h10-11,15,18-21H,2,5,8-9,12-13H2,1,3-4,6-7H3/b17-11+ |
| InChIKey | ZTSJUGQLNQCDRJ-GZTJUZNOSA-N |
| XLogP | 4.44 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|