C28H41Cl2FN2 — CID 138646970
(5Z,7Z)-9-chloro-1-N-[(3E,5E)-5-chloroocta-1,3,5,7-tetraen-3-yl]-3-N-cyclohexyl-5-fluoro-3-N-methyl-4-propan-2-yldeca-5,7,9-triene-1,3-diamine (PubChem CID 138646970) has the molecular formula C28H41Cl2FN2 and a molecular weight of 495.55 g/mol. Its IUPAC name is (5Z,7Z)-9-chloro-1-N-[(3E,5E)-5-chloroocta-1,3,5,7-tetraen-3-yl]-3-N-cyclohexyl-5-fluoro-3-N-methyl-4-propan-2-yldeca-5,7,9-triene-1,3-diamine.
| Compound Name | (5Z,7Z)-9-chloro-1-N-[(3E,5E)-5-chloroocta-1,3,5,7-tetraen-3-yl]-3-N-cyclohexyl-5-fluoro-3-N-methyl-4-propan-2-yldeca-5,7,9-triene-1,3-diamine |
|---|---|
| PubChem CID | 138646970 |
| Molecular Formula | C28H41Cl2FN2 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | (5Z,7Z)-9-chloro-1-N-[(3E,5E)-5-chloroocta-1,3,5,7-tetraen-3-yl]-3-N-cyclohexyl-5-fluoro-3-N-methyl-4-propan-2-yldeca-5,7,9-triene-1,3-diamine |
| SMILES | C=C/C=C(Cl)\C=C(/C=C)NCCC(C(/C(F)=C/C=C\C(=C)Cl)C(C)C)N(C)C1CCCCC1 |
| InChI | InChI=1S/C28H41Cl2FN2/c1-7-13-23(30)20-24(8-2)32-19-18-27(33(6)25-15-10-9-11-16-25)28(21(3)4)26(31)17-12-14-22(5)29/h7-8,12-14,17,20-21,25,27-28,32H,1-2,5,9-11,15-16,18-19H2,3-4,6H3/b14-12-,23-13+,24-20+,26-17- |
| InChIKey | PFUQTHVEPYQLMD-HZEMZBOSSA-N |
| XLogP | 8.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|