C17H24F2N3+ — CID 149236234
1,3-difluoro-N,N,5,6,7-pentamethyl-4,5,6,11a-tetrahydro-3H-pyrido[2,1-a][2,7]naphthyridin-7-ium-10-amine (PubChem CID 149236234) has the molecular formula C17H24F2N3+ and a molecular weight of 308.40 g/mol. Its IUPAC name is 1,3-difluoro-N,N,5,6,7-pentamethyl-4,5,6,11a-tetrahydro-3H-pyrido[2,1-a][2,7]naphthyridin-7-ium-10-amine.
| Compound Name | 1,3-difluoro-N,N,5,6,7-pentamethyl-4,5,6,11a-tetrahydro-3H-pyrido[2,1-a][2,7]naphthyridin-7-ium-10-amine |
|---|---|
| PubChem CID | 149236234 |
| Molecular Formula | C17H24F2N3+ |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 1,3-difluoro-N,N,5,6,7-pentamethyl-4,5,6,11a-tetrahydro-3H-pyrido[2,1-a][2,7]naphthyridin-7-ium-10-amine |
| SMILES | CC1C2=C(C(F)=NC(F)C2)C2C=C(N(C)C)C=C[N+]2(C)C1C |
| InChI | InChI=1S/C17H24F2N3/c1-10-11(2)22(5)7-6-12(21(3)4)8-14(22)16-13(10)9-15(18)20-17(16)19/h6-8,10-11,14-15H,9H2,1-5H3/q+1 |
| InChIKey | QHOYPGUSRITCJR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|