C24H40N+ — CID 91490113
but-1-en-2-yl-(4-ethyl-3,4-dimethyl-5-methylideneheptan-3-yl)-(6-ethylidenecyclohex-2-en-1-ylidene)azanium (PubChem CID 91490113) has the molecular formula C24H40N+ and a molecular weight of 342.59 g/mol. Its IUPAC name is but-1-en-2-yl-(4-ethyl-3,4-dimethyl-5-methylideneheptan-3-yl)-(6-ethylidenecyclohex-2-en-1-ylidene)azanium.
| Compound Name | but-1-en-2-yl-(4-ethyl-3,4-dimethyl-5-methylideneheptan-3-yl)-(6-ethylidenecyclohex-2-en-1-ylidene)azanium |
|---|---|
| PubChem CID | 91490113 |
| Molecular Formula | C24H40N+ |
| Molecular Weight | 342.59 g/mol |
| Exact Mass | 342.32 |
| IUPAC Name | but-1-en-2-yl-(4-ethyl-3,4-dimethyl-5-methylideneheptan-3-yl)-(6-ethylidenecyclohex-2-en-1-ylidene)azanium |
| SMILES | C=C(CC)/[N+](=C1/C=CCCC1=CC)C(C)(CC)C(C)(CC)C(=C)CC |
| InChI | InChI=1S/C24H40N/c1-10-19(6)23(8,13-4)24(9,14-5)25(20(7)11-2)22-18-16-15-17-21(22)12-3/h12,16,18H,6-7,10-11,13-15,17H2,1-5,8-9H3/q+1/b21-12?,25-22+ |
| InChIKey | BHGULDSYCOAJEU-WJZWHPSISA-N |
| XLogP | 7.21 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.59 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|