C21H34N+ — CID 123892674
1-but-2-en-2-yl-2,2,3-triethyl-3,6-dimethyl-5-methylidene-4-prop-2-enylidenepyridin-1-ium (PubChem CID 123892674) has the molecular formula C21H34N+ and a molecular weight of 300.51 g/mol. Its IUPAC name is 1-but-2-en-2-yl-2,2,3-triethyl-3,6-dimethyl-5-methylidene-4-prop-2-enylidenepyridin-1-ium.
| Compound Name | 1-but-2-en-2-yl-2,2,3-triethyl-3,6-dimethyl-5-methylidene-4-prop-2-enylidenepyridin-1-ium |
|---|---|
| PubChem CID | 123892674 |
| Molecular Formula | C21H34N+ |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | 1-but-2-en-2-yl-2,2,3-triethyl-3,6-dimethyl-5-methylidene-4-prop-2-enylidenepyridin-1-ium |
| SMILES | C=CC=C1C(=C)C(C)=[N+](C(C)=CC)C(CC)(CC)C1(C)CC |
| InChI | InChI=1S/C21H34N/c1-10-15-19-17(7)18(8)22(16(6)11-2)21(13-4,14-5)20(19,9)12-3/h10-11,15H,1,7,12-14H2,2-6,8-9H3/q+1 |
| InChIKey | NWIRFPNCZXJXJP-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|