C38H65N — CID 170029791
(E)-4-ethyl-7,9,10-trimethyl-N-[(4E)-3-methylidene-5-(1-methyl-2-methylidenecyclohexyl)-4-propylhepta-1,4-dien-2-yl]tetradec-6-en-5-imine (PubChem CID 170029791) has the molecular formula C38H65N and a molecular weight of 535.95 g/mol. Its IUPAC name is (E)-4-ethyl-7,9,10-trimethyl-N-[(4E)-3-methylidene-5-(1-methyl-2-methylidenecyclohexyl)-4-propylhepta-1,4-dien-2-yl]tetradec-6-en-5-imine.
| Compound Name | (E)-4-ethyl-7,9,10-trimethyl-N-[(4E)-3-methylidene-5-(1-methyl-2-methylidenecyclohexyl)-4-propylhepta-1,4-dien-2-yl]tetradec-6-en-5-imine |
|---|---|
| PubChem CID | 170029791 |
| Molecular Formula | C38H65N |
| Molecular Weight | 535.95 g/mol |
| Exact Mass | 535.51 |
| IUPAC Name | (E)-4-ethyl-7,9,10-trimethyl-N-[(4E)-3-methylidene-5-(1-methyl-2-methylidenecyclohexyl)-4-propylhepta-1,4-dien-2-yl]tetradec-6-en-5-imine |
| SMILES | C=C(/N=C(/C=C(\C)CC(C)C(C)CCCC)C(CC)CCC)C(=C)/C(CCC)=C(\CC)C1(C)CCCCC1=C |
| InChI | InChI=1S/C38H65N/c1-13-18-23-29(7)30(8)26-28(6)27-37(34(16-4)21-14-2)39-33(11)32(10)35(22-15-3)36(17-5)38(12)25-20-19-24-31(38)9/h27,29-30,34H,9-11,13-26H2,1-8,12H3/b28-27+,36-35+,39-37- |
| InChIKey | OUJMSDJLAIJKIV-LKBRAECASA-N |
| XLogP | 12.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.95 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|