C22H33N — CID 123514591
4,5,6-triethyl-2-[(1E)-hexa-1,4-dienyl]-3,3-dimethyl-5,6-dihydroindole (PubChem CID 123514591) has the molecular formula C22H33N and a molecular weight of 311.51 g/mol. Its IUPAC name is 4,5,6-triethyl-2-[(1E)-hexa-1,4-dienyl]-3,3-dimethyl-5,6-dihydroindole.
| Compound Name | 4,5,6-triethyl-2-[(1E)-hexa-1,4-dienyl]-3,3-dimethyl-5,6-dihydroindole |
|---|---|
| PubChem CID | 123514591 |
| Molecular Formula | C22H33N |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | 4,5,6-triethyl-2-[(1E)-hexa-1,4-dienyl]-3,3-dimethyl-5,6-dihydroindole |
| SMILES | CC=CC/C=C/C1=NC2=CC(CC)C(CC)C(CC)=C2C1(C)C |
| InChI | InChI=1S/C22H33N/c1-7-11-12-13-14-20-22(5,6)21-18(10-4)17(9-3)16(8-2)15-19(21)23-20/h7,11,13-17H,8-10,12H2,1-6H3/b11-7?,14-13+ |
| InChIKey | JKLSPDZAUIKCTQ-RZZDSPDXSA-N |
| XLogP | 6.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|