C39H60N2 — CID 91134333
7-(4-butyl-2-hexyl-3,3-dimethylcycloundec-4-en-1-yl)-2-[(4Z,6Z)-cycloocta-1,4,6-trien-1-yl]-5-ethylazepin-3-imine (PubChem CID 91134333) has the molecular formula C39H60N2 and a molecular weight of 556.92 g/mol. Its IUPAC name is 7-(4-butyl-2-hexyl-3,3-dimethylcycloundec-4-en-1-yl)-2-[(4Z,6Z)-cycloocta-1,4,6-trien-1-yl]-5-ethylazepin-3-imine.
| Compound Name | 7-(4-butyl-2-hexyl-3,3-dimethylcycloundec-4-en-1-yl)-2-[(4Z,6Z)-cycloocta-1,4,6-trien-1-yl]-5-ethylazepin-3-imine |
|---|---|
| PubChem CID | 91134333 |
| Molecular Formula | C39H60N2 |
| Molecular Weight | 556.92 g/mol |
| Exact Mass | 556.48 |
| IUPAC Name | 7-(4-butyl-2-hexyl-3,3-dimethylcycloundec-4-en-1-yl)-2-[(4Z,6Z)-cycloocta-1,4,6-trien-1-yl]-5-ethylazepin-3-imine |
| SMILES | [H]/N=c1\cc(CC)cc(C2CCCCCCC=C(CCCC)C(C)(C)C2CCCCCC)nc1C1=CC/C=C\C=C/C1 |
| InChI | InChI=1S/C39H60N2/c1-6-9-11-22-28-35-34(27-21-17-13-16-20-26-33(25-10-7-2)39(35,4)5)37-30-31(8-3)29-36(40)38(41-37)32-23-18-14-12-15-19-24-32/h12,14-15,18,24,26,29-30,34-35,40H,6-11,13,16-17,19-23,25,27-28H2,1-5H3/b15-12-,18-14-,32-24?,33-26?,40-36+ |
| InChIKey | REEXLKMXKPHAJN-XJBFXTMQSA-N |
| XLogP | 11.58 |
| TPSA | 36.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.92 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|