C18H25N2+ — CID 123693656
8-ethenyl-5-ethyl-3,5,6-trimethyl-2-methylidene-4-prop-1-enyl-1-azoniabicyclo[4.2.0]octa-1(8),3-dien-7-imine (PubChem CID 123693656) has the molecular formula C18H25N2+ and a molecular weight of 269.41 g/mol. Its IUPAC name is 8-ethenyl-5-ethyl-3,5,6-trimethyl-2-methylidene-4-prop-1-enyl-1-azoniabicyclo[4.2.0]octa-1(8),3-dien-7-imine.
| Compound Name | 8-ethenyl-5-ethyl-3,5,6-trimethyl-2-methylidene-4-prop-1-enyl-1-azoniabicyclo[4.2.0]octa-1(8),3-dien-7-imine |
|---|---|
| PubChem CID | 123693656 |
| Molecular Formula | C18H25N2+ |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 8-ethenyl-5-ethyl-3,5,6-trimethyl-2-methylidene-4-prop-1-enyl-1-azoniabicyclo[4.2.0]octa-1(8),3-dien-7-imine |
| SMILES | [H]/N=C1\C(C=C)=[N+]2C(=C)C(C)=C(C=CC)C(C)(CC)C12C |
| InChI | InChI=1S/C18H25N2/c1-8-11-14-12(4)13(5)20-15(9-2)16(19)18(20,7)17(14,6)10-3/h8-9,11,19H,2,5,10H2,1,3-4,6-7H3/q+1/b11-8?,19-16+ |
| InChIKey | WYOIYAZNETUJLS-QAJPEMNLSA-N |
| XLogP | 4.25 |
| TPSA | 26.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|