C20H27N — CID 123368675
3-methyl-N-[(1E)-2-(6-methyl-3,4,7,8-tetrahydronaphthalen-2-yl)buta-1,3-dienyl]butan-2-imine (PubChem CID 123368675) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is 3-methyl-N-[(1E)-2-(6-methyl-3,4,7,8-tetrahydronaphthalen-2-yl)buta-1,3-dienyl]butan-2-imine.
| Compound Name | 3-methyl-N-[(1E)-2-(6-methyl-3,4,7,8-tetrahydronaphthalen-2-yl)buta-1,3-dienyl]butan-2-imine |
|---|---|
| PubChem CID | 123368675 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 3-methyl-N-[(1E)-2-(6-methyl-3,4,7,8-tetrahydronaphthalen-2-yl)buta-1,3-dienyl]butan-2-imine |
| SMILES | C=C/C(=C\N=C(/C)C(C)C)C1=CC2=C(C=C(C)CC2)CC1 |
| InChI | InChI=1S/C20H27N/c1-6-17(13-21-16(5)14(2)3)19-10-9-18-11-15(4)7-8-20(18)12-19/h6,11-14H,1,7-10H2,2-5H3/b17-13+,21-16+ |
| InChIKey | AXAMYQZKBHETMI-PZGNMOBRSA-N |
| XLogP | 5.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|