C27H27N — CID 89001084
2-[10-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-7-methyl-2,3-dihydroanthracen-9-yl]-3,4-dihydropyridine (PubChem CID 89001084) has the molecular formula C27H27N and a molecular weight of 365.52 g/mol. Its IUPAC name is 2-[10-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-7-methyl-2,3-dihydroanthracen-9-yl]-3,4-dihydropyridine.
| Compound Name | 2-[10-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-7-methyl-2,3-dihydroanthracen-9-yl]-3,4-dihydropyridine |
|---|---|
| PubChem CID | 89001084 |
| Molecular Formula | C27H27N |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 2-[10-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-7-methyl-2,3-dihydroanthracen-9-yl]-3,4-dihydropyridine |
| SMILES | C=C/C=C\C=C(/C)c1c2c(c(C3=NC=CCC3)c3cc(C)ccc13)=CCCC=2 |
| InChI | InChI=1S/C27H27N/c1-4-5-6-11-20(3)26-21-12-7-8-13-22(21)27(25-14-9-10-17-28-25)24-18-19(2)15-16-23(24)26/h4-6,10-13,15-18H,1,7-9,14H2,2-3H3/b6-5-,20-11+ |
| InChIKey | UMUZPFTWVGNODP-KNLMRNNNSA-N |
| XLogP | 5.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|