C14H13N — CID 57190730
4,10a-dihydro-1H-benzo[c][1]benzazepine (PubChem CID 57190730) has the molecular formula C14H13N and a molecular weight of 195.27 g/mol. Its IUPAC name is 4,10a-dihydro-1H-benzo[c][1]benzazepine.
| Compound Name | 4,10a-dihydro-1H-benzo[c][1]benzazepine |
|---|---|
| PubChem CID | 57190730 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 4,10a-dihydro-1H-benzo[c][1]benzazepine |
| SMILES | C1=CC2=CN=C3CC=CCC3=CC2C=C1 |
| InChI | InChI=1S/C14H13N/c1-2-7-13-10-15-14-8-4-3-6-12(14)9-11(13)5-1/h1-5,7,9-11H,6,8H2 |
| InChIKey | NAWMXXUZOKQVRG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|