C14H15N — CID 57282707
6a,7,10,11a-tetrahydro-6H-benzo[b][1]benzazepine (PubChem CID 57282707) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 6a,7,10,11a-tetrahydro-6H-benzo[b][1]benzazepine.
| Compound Name | 6a,7,10,11a-tetrahydro-6H-benzo[b][1]benzazepine |
|---|---|
| PubChem CID | 57282707 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 6a,7,10,11a-tetrahydro-6H-benzo[b][1]benzazepine |
| SMILES | C1=CC2=CCC3CC=CCC3=NC2C=C1 |
| InChI | InChI=1S/C14H15N/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)15-13/h1-5,7,9,12-13H,6,8,10H2 |
| InChIKey | AOLQFXKLLBWFFH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|